Benzamide, 4-(3-ethyl-3-methyl-1-triazenyl)- structure
|
Common Name | Benzamide, 4-(3-ethyl-3-methyl-1-triazenyl)- | ||
|---|---|---|---|---|
| CAS Number | 59708-19-9 | Molecular Weight | 206.24400 | |
| Density | 1.16g/cm3 | Boiling Point | 350.1ºC at 760 mmHg | |
| Molecular Formula | C10H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.5ºC | |
| Name | 4-[[ethyl(methyl)amino]diazenyl]benzamide |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 350.1ºC at 760 mmHg |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.24400 |
| Flash Point | 165.5ºC |
| Exact Mass | 206.11700 |
| PSA | 71.05000 |
| LogP | 2.43620 |
| Index of Refraction | 1.573 |
| InChIKey | MUAXPXOIJKSJQC-UHFFFAOYSA-N |
| SMILES | CCN(C)N=Nc1ccc(C(N)=O)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |