Methyl 4-(3-(hydroxymethyl)-3-methyl-1-triazenyl)benzoate structure
|
Common Name | Methyl 4-(3-(hydroxymethyl)-3-methyl-1-triazenyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 69467-93-2 | Molecular Weight | 223.22900 | |
| Density | 1.2g/cm3 | Boiling Point | 348.9ºC at 760 mmHg | |
| Molecular Formula | C10H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | methyl 4-[[hydroxymethyl(methyl)amino]diazenyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 348.9ºC at 760 mmHg |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.22900 |
| Flash Point | 164.8ºC |
| Exact Mass | 223.09600 |
| PSA | 74.49000 |
| LogP | 1.35350 |
| Index of Refraction | 1.55 |
| InChIKey | BLAFWWCVPZFQTO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N=NN(C)CO)cc1 |
|
~54%
Methyl 4-(3-(hy... CAS#:69467-93-2 |
| Literature: Lafrance, Ronald J.; Tang, York; Vaughan, Keith; Hooper Donald L. Journal of the Chemical Society, Chemical Communications, 1983 , # 13 p. 721 - 722 |
|
~%
Methyl 4-(3-(hy... CAS#:69467-93-2 |
| Literature: Vaughan; Tang; Llanos; Horton; Simmonds; Hickman; Stevens Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 357 - 363 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| 1-[p-(methoxycarbonyl)phenyl]-3-(hydroxymethyl)-3-methyltriazene |
| Methyl 4-(3-(hydroxymethyl)-3-methyl-1-triazenyl)benzoate |