4-[[hydroxymethyl(methyl)amino]diazenyl]benzamide structure
|
Common Name | 4-[[hydroxymethyl(methyl)amino]diazenyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 70346-61-1 | Molecular Weight | 208.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[hydroxymethyl(methyl)amino]diazenyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12N4O2 |
|---|---|
| Molecular Weight | 208.21700 |
| Exact Mass | 208.09600 |
| PSA | 91.28000 |
| LogP | 1.36610 |
| InChIKey | YQDDGBUWRRRNAY-UHFFFAOYSA-N |
| SMILES | CN(CO)N=Nc1ccc(C(N)=O)cc1 |
|
~%
4-[[hydroxymeth... CAS#:70346-61-1 |
| Literature: Vaughan; Tang; Llanos; Horton; Simmonds; Hickman; Stevens Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 357 - 363 |
|
~%
4-[[hydroxymeth... CAS#:70346-61-1 |
| Literature: Iley, James N.; Moreira, Rui; Rosa, Eduarda Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1987 , p. 1503 - 1508 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| Benzamide,4-[3-(hydroxymethyl)-3-methyl-1-triazenyl] |