4-(Benzyloxy)benzenesulfonic acid
Modify Date: 2025-08-26 10:17:19
4-(Benzyloxy)benzenesulfonic acid structure
|
Common Name | 4-(Benzyloxy)benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 5950-16-3 | Molecular Weight | 264.29700 | |
| Density | 1.342g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(Benzyloxy)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.29700 |
| Exact Mass | 264.04600 |
| PSA | 71.98000 |
| LogP | 3.59310 |
| Index of Refraction | 1.609 |
| InChIKey | OFLZPFKSCNKXER-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(OCc2ccccc2)cc1 |
|
~56%
4-(Benzyloxy)be... CAS#:5950-16-3 |
| Literature: Glossop, Paul Alan; Lane, Charlotte Alice Louise Patent: US2009/76152 A1, 2009 ; Location in patent: Page/Page column 13-14 ; US 20090076152 A1 |
|
~31%
4-(Benzyloxy)be... CAS#:5950-16-3 |
| Literature: Brinner, Kristin M; Mi Kim, Jin; Habashita, Hiromu; Gluzman, Ilya Y; Goldberg, Daniel E; Ellman, Jonathan A Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 11 p. 3649 - 3661 |
|
~%
4-(Benzyloxy)be... CAS#:5950-16-3 |
| Literature: Schultz; Ichenhaeuser Journal fuer Praktische Chemie (Leipzig), 1908 , vol. <2> 77, p. 114 |
|
~%
4-(Benzyloxy)be... CAS#:5950-16-3 |
| Literature: Schultz; Ichenhaeuser Journal fuer Praktische Chemie (Leipzig), 1908 , vol. <2> 77, p. 114 |
| 4-Benzyloxy-o-phenylendiamin |
| 4-benzyloxy-benzenesulfonic acid |
| p-benzyloxybenzenesulfonic acid |
| 4-Benzyloxy-benzolsulfonsaeure |
| 4-benzyloxybenzene-1,2-diamine |
| 4-Benzyloxybenzene sulphonic acid |
| 4-benzyloxy-1,2-phenylenediamine |
| 4-BENZYLOXY-1,2-PHENYLENEDIAMINE DIHYDROCHLORIDE |