Nimbin structure
|
Common Name | Nimbin | ||
|---|---|---|---|---|
| CAS Number | 5945-86-8 | Molecular Weight | 540.601 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 606.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H36O9 | Melting Point | 197-199ºC (dec.) | |
| MSDS | N/A | Flash Point | 320.4±31.5 °C | |
Use of NimbinNimbin is a intermediate limonoid isolated from Azadirachta. Nimbin prevents tau aggregation and increases cell viability. Nimbin is effective inhibits the envelope protein of dengue virus. Nimbin has anti-inflammatory, antipyretic, antifungal, antihistamine, antiseptic, antioxidant, anti-cancer and anti-viral properties. Nimbin can across blood-brain barrier[1][2][3]. |
| Name | nimbin |
|---|---|
| Synonym | More Synonyms |
| Description | Nimbin is a intermediate limonoid isolated from Azadirachta. Nimbin prevents tau aggregation and increases cell viability. Nimbin is effective inhibits the envelope protein of dengue virus. Nimbin has anti-inflammatory, antipyretic, antifungal, antihistamine, antiseptic, antioxidant, anti-cancer and anti-viral properties. Nimbin can across blood-brain barrier[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 606.1±55.0 °C at 760 mmHg |
| Melting Point | 197-199ºC (dec.) |
| Molecular Formula | C30H36O9 |
| Molecular Weight | 540.601 |
| Flash Point | 320.4±31.5 °C |
| Exact Mass | 540.235962 |
| PSA | 118.34000 |
| LogP | 3.93 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | NHOIBRJOQAYBJT-IMGVWCFESA-N |
| SMILES | COC(=O)CC1C2(C)C3=C(C)C(c4ccoc4)CC3OC2C(OC(C)=O)C2C(C)(C(=O)OC)C=CC(=O)C21C |
| Storage condition | 2-8C |
| HS Code | 13021920 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Nimbin |
| Methyl (2R,3aR,4aS,5R,5aR,6R,9aR,10S,10aR)-5-acetoxy-2-(3-furyl)-10-(2-methoxy-2-oxoethyl)-1,6,9a,10a-tetramethyl-9-oxo-3,3a,4a,5,5a,6,9,9a,10,10a-decahydro-2H-cyclopenta[b]naphtho[2,3-d]furan-6-carboxylate |
| (4a,5a,6a,7a,15b,17a)-6-(Acetyloxy)-7,15:21,23-diepoxy-4,8-dimethyl-1-oxo-18,24-dinor-11,12-secochola-2,13,20,22-tetraene-4,11-dicarboxylic Acid Dimethyl Ester |
| methyl (2R,3aR,4aS,5R,5aR,6R,9aR,10S,10aR)-5-(acetyloxy)-2-(furan-3-yl)-10-(2-methoxy-2-oxoethyl)-1,6,9a,10a-tetramethyl-9-oxo-3,3a,4a,5,5a,6,9,9a,10,10a-decahydro-2H-cyclopenta[b]naphtho[2,3-d]furan-6-carboxylate |
| 2H-Cyclopenta[b]naphtho[2,3-d]furan-10-acetic acid, 5-(acetyloxy)-2-(3-furanyl)-3,3a,4a,5,5a,6,9,9a,10,10a-decahydro-6-(methoxycarbonyl)-1,6,9a,10a-tetramethyl-9-oxo-, methyl ester, (2R,3aR,4aS,5R,5aR,6R,9aR,10S,10aR)- |