Carburazepam
Modify Date: 2025-08-24 19:51:27
Carburazepam structure
|
Common Name | Carburazepam | ||
|---|---|---|---|---|
| CAS Number | 59009-93-7 | Molecular Weight | 329.78100 | |
| Density | 1.334g/cm3 | Boiling Point | 565.5ºC at 760 mmHg | |
| Molecular Formula | C17H16ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.8ºC | |
Use of CarburazepamCarburazepam is a drug which derives from benzodiazepine. Benzodiazepines (BZD, BZs) are a class of psychoactive drugs whose core chemical structure is the fusion of a benzene ring and a diazepine ring. |
| Name | 7-Chloro-1-methyl-2-oxo-5-phenyl-1,2,3,5-tetrahydro-4H-1,4-benzod iazepine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | Carburazepam is a drug which derives from benzodiazepine. Benzodiazepines (BZD, BZs) are a class of psychoactive drugs whose core chemical structure is the fusion of a benzene ring and a diazepine ring. |
|---|---|
| Related Catalog | |
| In Vitro | Carburazepam is a drug which derives from benzodiazepine. Benzodiazepines(BZD, BZs) are a class of psychoactive drugs whose core chemical structure is the fusion of a benzene ring and a diazepine ring[1]. |
| References |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 565.5ºC at 760 mmHg |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.78100 |
| Flash Point | 295.8ºC |
| Exact Mass | 329.09300 |
| PSA | 67.63000 |
| LogP | 3.30320 |
| Index of Refraction | 1.629 |
| InChIKey | HFFJORVBQWPILU-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN(C(N)=O)C(c2ccccc2)c2cc(Cl)ccc21 |
| Storage condition | 2-8℃ |
|
~%
Carburazepam CAS#:59009-93-7 |
| Literature: Richter Gedeon Vegyeszeti Gyar RT Patent: US4342755 A1, 1982 ; |
|
~%
Carburazepam CAS#:59009-93-7 |
| Literature: Richter Gedeon Vegyeszeti Gyar RT Patent: US4342755 A1, 1982 ; |
|
~%
Carburazepam CAS#:59009-93-7 |
| Literature: Richter Gedeon Vegyeszeti Gyar RT Patent: US4342755 A1, 1982 ; |
|
~%
Carburazepam CAS#:59009-93-7 |
| Literature: Richter Gedeon Vegyeszeti Gyar RT Patent: US4342755 A1, 1982 ; |
![7-chloro-1-methyl-2-oxo-5-phenyl-1,2,3,5-tetrahydro-benzo[e][1,4]diazepine-4-carbonyl chloride structure](https://image.chemsrc.com/caspic/230/59010-25-2.png)
![7-chloro-2-oxo-5-phenyl-1,2,3,5-tetrahydro-benzo[e][1,4]diazepine-4-carboxylic acid amide structure](https://image.chemsrc.com/caspic/248/59009-95-9.png)
| 1-methyl-4-carbamoyl-5-phenyl-7-chloro-1,3,4,5-tetrahydro-2H-1,4-benzodiazepine-2-one |
| Aethan-1,1,2-tricarbonsaeure |
| 1,2-Ethanetricarboxylic acid |
| Cabraleahydroxylacton |
| 2-carboxy-1,4-butanedioic acid |
| carboxysuccinic acid |
| ethane-1,1,2-tricarboxylate |
| carbraleahydroxylactone |
| tricarboxyethane |
| carburazepam |
| 7-chloro-1-methyl-2-oxo-5-phenyl-1,2,3,5-tetrahydro-benzo[e][1,4]diazepine-4-carboxylic acid amide |
| 1,1,2-Ethanetricarboxylicacid |
| cabralea-hydroxylactone |