Ophiopogonanone E
Modify Date: 2025-08-25 18:19:51
Ophiopogonanone E structure
|
Common Name | Ophiopogonanone E | ||
|---|---|---|---|---|
| CAS Number | 588706-66-5 | Molecular Weight | 360.36 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 620.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9±25.0 °C | |
Use of Ophiopogonanone EOphiopogonanone E is a homoisoflavonoid, that can be isolated from the fibrous roots of Polygonatum odoratum[1]. |
| Name | 5,7-dihydroxy-3-(2-hydroxy-4-methoxybenzyl)-8-methoxy-6-methylchroman-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ophiopogonanone E is a homoisoflavonoid, that can be isolated from the fibrous roots of Polygonatum odoratum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 620.5±55.0 °C at 760 mmHg |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 |
| Flash Point | 224.9±25.0 °C |
| Exact Mass | 360.120911 |
| PSA | 105.45000 |
| LogP | 3.92 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | FMFZMWWKEGLLRS-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2COc3c(OC)c(O)c(C)c(O)c3C2=O)c(O)c1 |
| Hazard Codes | Xi |
|---|
| Ophiopogonanone E |
| 5,7-Dihydroxy-3-(2-hydroxy-4-methoxybenzyl)-8-methoxy-6-methyl-2,3-dihydro-4H-chromen-4-one |
| 5,7-Dihydroxy-3-(2-hydroxy-4-methoxy-benzyl)-8-methoxy-6-methyl-chroman-4-one |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-8-methoxy-6-methyl- |