4,5-Dichloro-2-(2,4-dichlorophenoxy)aniline structure
|
Common Name | 4,5-Dichloro-2-(2,4-dichlorophenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 58802-26-9 | Molecular Weight | 323.00200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7Cl4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-dichloro-2-(2,4-dichloro-phenoxy)-aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7Cl4NO |
|---|---|
| Molecular Weight | 323.00200 |
| Exact Mass | 320.92800 |
| PSA | 35.25000 |
| LogP | 6.25590 |
| InChIKey | MXRQOWDVBFCQFE-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(Cl)cc1Oc1ccc(Cl)cc1Cl |
| HS Code | 2922299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4.5.2'.4'-Tetrachlor-2-amino-diphenylaether |
| 4,5-Dichlor-2-(2,4-dichlor-phenoxy)-anilin |
| 4,5,2',4'-Tetrachlor-2-aminodiphenylaether |