4,5-dichloro-2-(2,4-dichlorophenoxy)phenol structure
|
Common Name | 4,5-dichloro-2-(2,4-dichlorophenoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 3380-44-7 | Molecular Weight | 323.98700 | |
| Density | 1.57g/cm3 | Boiling Point | 374.1ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.1ºC | |
| Name | 4,5-dichloro-2-(2,4-dichlorophenoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 374.1ºC at 760 mmHg |
| Molecular Formula | C12H6Cl4O2 |
| Molecular Weight | 323.98700 |
| Flash Point | 180.1ºC |
| Exact Mass | 321.91200 |
| PSA | 29.46000 |
| LogP | 5.79810 |
| Index of Refraction | 1.638 |
| InChIKey | MCNUFYGRHZLQGD-UHFFFAOYSA-N |
| SMILES | Oc1cc(Cl)c(Cl)cc1Oc1ccc(Cl)cc1Cl |
| HS Code | 2909500000 |
|---|
|
~99%
4,5-dichloro-2-... CAS#:3380-44-7 |
| Literature: Humppi Synthesis, 1985 , vol. NO. 10, p. 919 - 924 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2',4,4',5-Tetrachloro-2-hydroxydiphenyl ether |