4,5-dichloro-2-(2,4,5-trichlorophenoxy)phenol
Modify Date: 2025-09-28 14:36:44
4,5-dichloro-2-(2,4,5-trichlorophenoxy)phenol structure
|
Common Name | 4,5-dichloro-2-(2,4,5-trichlorophenoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 61639-90-5 | Molecular Weight | 358.43200 | |
| Density | 1.642g/cm3 | Boiling Point | 399.6ºC at 760 mmHg | |
| Molecular Formula | C12H5Cl5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.4ºC | |
| Name | 4,5-dichloro-2-(2,4,5-trichlorophenoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642g/cm3 |
|---|---|
| Boiling Point | 399.6ºC at 760 mmHg |
| Molecular Formula | C12H5Cl5O2 |
| Molecular Weight | 358.43200 |
| Flash Point | 195.4ºC |
| Exact Mass | 355.87300 |
| PSA | 29.46000 |
| LogP | 6.45150 |
| Index of Refraction | 1.644 |
| InChIKey | CMCNHNDDWPGEBH-UHFFFAOYSA-N |
| SMILES | Oc1cc(Cl)c(Cl)cc1Oc1cc(Cl)c(Cl)cc1Cl |
|
~%
4,5-dichloro-2-... CAS#:61639-90-5 |
| Literature: Goethe,R.; Wachtmeister,C.A. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1976 , vol. B 30, # 8 p. 796 |
|
~%
4,5-dichloro-2-... CAS#:61639-90-5 |
| Literature: Goethe,R.; Wachtmeister,C.A. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1976 , vol. B 30, # 8 p. 796 |
| 2,4,4',5,5'-Pentachlor-2'-hydroxydiphenylether |