Phenylalanine,phenylmethyl ester, hydrochloride (1:1)
Modify Date: 2025-09-21 11:35:27
Phenylalanine,phenylmethyl ester, hydrochloride (1:1) structure
|
Common Name | Phenylalanine,phenylmethyl ester, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 58780-66-8 | Molecular Weight | 291.77300 | |
| Density | 1.142g/cm3 | Boiling Point | 382.8ºC at 760mmHg | |
| Molecular Formula | C16H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | benzyl 2-amino-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 382.8ºC at 760mmHg |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.77300 |
| Flash Point | 220.3ºC |
| Exact Mass | 291.10300 |
| PSA | 52.32000 |
| LogP | 3.80210 |
| InChIKey | CEXFHIYDTRNBJD-UHFFFAOYSA-N |
| SMILES | Cl.NC(Cc1ccccc1)C(=O)OCc1ccccc1 |
| HS Code | 2922499990 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:2462-32-0
CAS#:87004-78-2
CAS#:63-91-2| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Phenylalanine O-benzyl ester |
| DL-Phenylalanin-benzylester,Hydrochlorid |
| benzyl phenylalaninate hydrochloride |
| phenylalanine benzyl ester hydrochloride |
| DL-phenylalanine benzyl ester,hydrochloride |
| L-Phenylalanine phenylmethyl ester |
| Benzyl 3-phenyl-L-alaninate HCl |