H-Phe-Obzl HCl structure
|
Common Name | H-Phe-Obzl HCl | ||
|---|---|---|---|---|
| CAS Number | 2462-32-0 | Molecular Weight | 291.773 | |
| Density | N/A | Boiling Point | 382.8ºC at 760 mmHg | |
| Molecular Formula | C16H18ClNO2 | Melting Point | 197-200 °C | |
| MSDS | USA | Flash Point | N/A | |
Use of H-Phe-Obzl HClL-Phenylalanine benzyl ester (hydrochloride) is a phenylalanine derivative[1]. |
| Name | L-Phenylalanine benzyl ester hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | L-Phenylalanine benzyl ester (hydrochloride) is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 382.8ºC at 760 mmHg |
|---|---|
| Melting Point | 197-200 °C |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.773 |
| Exact Mass | 291.102600 |
| PSA | 52.32000 |
| LogP | 3.80210 |
| Vapour Pressure | 4.62E-06mmHg at 25°C |
| Index of Refraction | -12 ° (C=1, 80% acetic acid) |
| InChIKey | CEXFHIYDTRNBJD-RSAXXLAASA-N |
| SMILES | Cl.NC(Cc1ccccc1)C(=O)OCc1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922499990 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| H-L-Phe-OBzl*HCl |
| H-Phe-OBn hydrochloride |
| PHE-OBZL HCL |
| H-Phe-OBzl·HCl |
| L-Phenylalanine Benzyl Ester Hydrochloride |
| H-Phe-OBzl.HCl |
| H-PHE-OBZL.HCI |
| L-phenylalanin benzyl ester hydrochloride |
| H-Phe-OBzl,HCl |
| Benzeneethanaminium, α-[(phenylmethoxy)carbonyl]-, chloride, (αS)- (1:1) |
| L-Phenylalanine Benzyl Ester HCl |
| PHENYLALANINE-OBZL HCL |
| (S)-Benzyl 2-amino-3-phenylpropanoate hydrochloride |
| Phenylalanine,benzyl ester hydrochloride |
| EINECS 219-558-3 |
| H-Phe-OBzl hydrochloride |
| (2S)-1-(Benzyloxy)-1-oxo-3-phenyl-2-propanaminium chloride |
| benzyl 3-phenyl-L-alaninate hydrochloride |
| MFCD00043249 |
| H-Phe-Obzl HCl |