Rebaudioside B structure
|
Common Name | Rebaudioside B | ||
|---|---|---|---|---|
| CAS Number | 58543-17-2 | Molecular Weight | 804.87200 | |
| Density | 1.53g/cm3 | Boiling Point | 1000.6ºC at 760mmHg | |
| Molecular Formula | C38H60O18 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 302.5ºC | |
Use of Rebaudioside BRebaudioside B is the minor constituent isolated from the leaves of Stevia rebaudiana Bertoni. Rebaudioside B tastes about 150 times sweeter than sucrose [1]. |
| Name | rebaudioside B |
|---|---|
| Synonym | More Synonyms |
| Description | Rebaudioside B is the minor constituent isolated from the leaves of Stevia rebaudiana Bertoni. Rebaudioside B tastes about 150 times sweeter than sucrose [1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 1000.6ºC at 760mmHg |
| Molecular Formula | C38H60O18 |
| Molecular Weight | 804.87200 |
| Flash Point | 302.5ºC |
| Exact Mass | 804.37800 |
| PSA | 294.98000 |
| Index of Refraction | 1.645 |
| InChIKey | DRSKVOAJKLUMCL-MMUIXFKXSA-M |
| SMILES | C=C1CC23CCC4C(C)(C(=O)[O-])CCCC4(C)C2CCC1(OC1OC(CO)C(O)C(OC2OC(CO)C(O)C(O)C2O)C1OC1OC(CO)C(O)C(O)C1O)C3 |
|
~%
Rebaudioside B CAS#:58543-17-2 |
| Literature: Well, Caroline; Frank, Oliver; Hofmann, Thomas Journal of Agricultural and Food Chemistry, 2013 , vol. 61, # 47 p. 11312 - 11320 |
|
~%
Rebaudioside B CAS#:58543-17-2 |
| Literature: Journal of Agricultural and Food Chemistry, , vol. 60, # 27 p. 6782 - 6793 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| iso-reabaudioside B |