Ethyl 3-(2,4-difluorophenyl)-3-oxopropanoate
Modify Date: 2024-01-04 23:53:30
Ethyl 3-(2,4-difluorophenyl)-3-oxopropanoate structure
|
Common Name | Ethyl 3-(2,4-difluorophenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 58101-23-8 | Molecular Weight | 228.192 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 276.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H10F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.1±18.1 °C | |
| Name | ethyl 3-(2,4-difluorophenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 276.0±25.0 °C at 760 mmHg |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.192 |
| Flash Point | 117.1±18.1 °C |
| Exact Mass | 228.059799 |
| PSA | 43.37000 |
| LogP | 1.59 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | UFAHWLKYHPRYSY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(F)cc1F |
|
~91%
Ethyl 3-(2,4-di... CAS#:58101-23-8 |
| Literature: Li, Sai; Jiang, Rui; Qin, Mingze; Liu, Haicheng; Zhang, Guangyan; Gong, Ping Archiv der Pharmazie, 2013 , vol. 346, # 7 p. 521 - 533 |
|
~%
Ethyl 3-(2,4-di... CAS#:58101-23-8 |
| Literature: US5457104 A1, ; |
|
~%
Ethyl 3-(2,4-di... CAS#:58101-23-8 |
| Literature: US2012/277224 A1, ; US 20120277224 A1 |
|
~%
Ethyl 3-(2,4-di... CAS#:58101-23-8 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 11 p. 2843 - 2855 |
| FR CF DV1VO2 |
| Ethyl 3-(2,4-difluorophenyl)-3-oxopropionate |
| 2,4-Difluorobenzoylacetic acid ethyl ester |
| Ethyl 3-(2,4-difluorophenyl)-3-oxopropanoate |
| Ethyl 2,4-difluorobenzoylacetate |
| Benzenepropanoic acid, 2,4-difluoro-β-oxo-, ethyl ester |
| Ethyl 2,4-difluoro-β-oxo-benzenepropanoate |