Ethyl 3-(2,4-dimethylphenyl)-3-oxopropanoate
Modify Date: 2025-09-30 16:07:43
Ethyl 3-(2,4-dimethylphenyl)-3-oxopropanoate structure
|
Common Name | Ethyl 3-(2,4-dimethylphenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 51725-81-6 | Molecular Weight | 220.264 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 310.1±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.3±23.8 °C | |
| Name | Ethyl 3-(2,4-dimethylphenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 310.1±27.0 °C at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.264 |
| Flash Point | 133.3±23.8 °C |
| Exact Mass | 220.109940 |
| PSA | 43.37000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | CVDODYMUMJOSGP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(C)cc1C |
|
~40%
Ethyl 3-(2,4-di... CAS#:51725-81-6 |
| Literature: Zhu, Youquan; Zou, Xiaomao; Hu, Fangzhong; Yao, Changsheng; Liu, Bin; Yang, Huazheng Journal of Agricultural and Food Chemistry, 2005 , vol. 53, # 24 p. 9566 - 9570 |
|
~%
Ethyl 3-(2,4-di... CAS#:51725-81-6 |
|
Literature: Wojack,G. Diss. |
| Benzenepropanoic acid, 2,4-dimethyl-β-oxo-, ethyl ester |
| Ethyl 3-(2,4-dimethylphenyl)-3-oxopropanoate |
| Ethyl (2,4-dimethylbenzoyl)acetate |