4-Bromo-4',4''-dimethyltriphenylamine structure
|
Common Name | 4-Bromo-4',4''-dimethyltriphenylamine | ||
|---|---|---|---|---|
| CAS Number | 58047-42-0 | Molecular Weight | 352.268 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 459.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H18BrN | Melting Point | 102ºC | |
| MSDS | USA | Flash Point | 232.0±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Bromo-4',4''-dimethyltriphenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.9±45.0 °C at 760 mmHg |
| Melting Point | 102ºC |
| Molecular Formula | C20H18BrN |
| Molecular Weight | 352.268 |
| Flash Point | 232.0±28.7 °C |
| Exact Mass | 351.062256 |
| PSA | 3.24000 |
| LogP | 7.67 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | YMNJJMJHTXGFOR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(Br)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-(4-bromophenyl)-4-methyl-N-(4-methylphenyl)aniline |
| Benzenamine, 4-bromo-N,N-bis(4-methylphenyl)- |
| 4-Bromo-N,N-bis(4-methylphenyl)aniline |
| 4-bromo-N,N-di-p-tolylaniline |