4-Bromo-4'-tert-Butylbenzophenone structure
|
Common Name | 4-Bromo-4'-tert-Butylbenzophenone | ||
|---|---|---|---|---|
| CAS Number | 162258-89-1 | Molecular Weight | 289.21000 | |
| Density | 1.217g/cm3 | Boiling Point | 152ºC/2mm | |
| Molecular Formula | C16H17Br | Melting Point | 143ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Bromo-4'-tert-butylbiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 152ºC/2mm |
| Melting Point | 143ºC |
| Molecular Formula | C16H17Br |
| Molecular Weight | 289.21000 |
| Exact Mass | 288.05100 |
| LogP | 5.41360 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | QYNWFBYWVPMMRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(-c2ccc(Br)cc2)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903999090 |
|
~74%
4-Bromo-4'-tert... CAS#:162258-89-1 |
| Literature: Murphy, Sean; Yang, Xiquiang; Schuster, Gary B. Journal of Organic Chemistry, 1995 , vol. 60, # 8 p. 2411 - 2422 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Bromo-4′-tert-butylbiphenyl |
| 1-bromo-4-(4-tert-butylphenyl)benzene |