Lobelanine structure
|
Common Name | Lobelanine | ||
|---|---|---|---|---|
| CAS Number | 579-21-5 | Molecular Weight | 335.43900 | |
| Density | 1.076g/cm3 | Boiling Point | 476.4ºC at 760mmHg | |
| Molecular Formula | C22H25NO2 | Melting Point | 99° | |
| MSDS | N/A | Flash Point | 196.2ºC | |
Use of LobelanineLobelanine (8,10-Diphenyllobelidione) is a chemical precursor for the biosynthesis of Lobeline. Lobeline is a partial nicotinic agonist and is used as a smoking cessation agent[1][2]. |
| Name | 2-[(2R,6S)-1-methyl-6-phenacylpiperidin-2-yl]-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Lobelanine (8,10-Diphenyllobelidione) is a chemical precursor for the biosynthesis of Lobeline. Lobeline is a partial nicotinic agonist and is used as a smoking cessation agent[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.076g/cm3 |
|---|---|
| Boiling Point | 476.4ºC at 760mmHg |
| Melting Point | 99° |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.43900 |
| Flash Point | 196.2ºC |
| Exact Mass | 335.18900 |
| PSA | 37.38000 |
| LogP | 4.32320 |
| Index of Refraction | 1.554 |
| InChIKey | IDEMKXUAULKYJV-BGYRXZFFSA-N |
| SMILES | CN1C(CC(=O)c2ccccc2)CCCC1CC(=O)c1ccccc1 |
| Storage condition | 2-8°C |
| RIDADR | UN 1544 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| Lobelanine |
| 1-Methyl-2r,6c-diphenacyl-piperidin |
| cis-2,2'-(1-methyl-2,6-piperidinediyl)bis[1-phenyl-ethanone] |
| 1-methyl-2r,6c-diphenacyl-piperidine |
| Ethanone,2,2'-(1-methyl-2,6-piperidinediyl)bis(1-phenyl-,cis |