Ac-Gly-Ala-Lys(Ac)-AMC structure
|
Common Name | Ac-Gly-Ala-Lys(Ac)-AMC | ||
|---|---|---|---|---|
| CAS Number | 577969-56-3 | Molecular Weight | 515.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H33N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ac-Gly-Ala-Lys(Ac)-AMCAc-Gly-Ala-Lys(Ac)-AMC is a fluorogenic substrate for the determination of protease activity. Ac-Gly-Ala-Lys(Ac)-AMC undergoes hydrolysis and releases the fluorescent product 7-amino-4-methylcoumarin (AMC). AMC is fluorescent under UV light and can emit a fluorescent signal[1]. |
| Name | acetyl-Gly-Ala-(N-acetyl-Lys)-AMC |
|---|---|
| Synonym | More Synonyms |
| Description | Ac-Gly-Ala-Lys(Ac)-AMC is a fluorogenic substrate for the determination of protease activity. Ac-Gly-Ala-Lys(Ac)-AMC undergoes hydrolysis and releases the fluorescent product 7-amino-4-methylcoumarin (AMC). AMC is fluorescent under UV light and can emit a fluorescent signal[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H33N5O7 |
|---|---|
| Molecular Weight | 515.56 |
| Exact Mass | 515.23800 |
| PSA | 175.71000 |
| LogP | 2.10850 |
| InChIKey | SUCZARDVMMDJRT-YWZLYKJASA-N |
| SMILES | CC(=O)NCCCCC(NC(=O)C(C)NC(=O)CNC(C)=O)C(=O)Nc1ccc2c(C)cc(=O)oc2c1 |
| AC-GLY-ALA-LYS(AC)-AMC |
| Ac-GAK(Ac)-AMC |