Glycine,N-(3-chlorobenzoyl)- structure
|
Common Name | Glycine,N-(3-chlorobenzoyl)- | ||
|---|---|---|---|---|
| CAS Number | 57728-59-3 | Molecular Weight | 213.61800 | |
| Density | N/A | Boiling Point | 440.5ºC at 760 mmHg | |
| Molecular Formula | C9H8ClNO3 | Melting Point | 144-147ºC | |
| MSDS | N/A | Flash Point | 220.2ºC | |
| Name | 2-[(3-chlorobenzoyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 440.5ºC at 760 mmHg |
|---|---|
| Melting Point | 144-147ºC |
| Molecular Formula | C9H8ClNO3 |
| Molecular Weight | 213.61800 |
| Flash Point | 220.2ºC |
| Exact Mass | 213.01900 |
| PSA | 66.40000 |
| LogP | 1.54530 |
| InChIKey | ICYUIIJXZHPESK-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)c1cccc(Cl)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~%
Glycine,N-(3-ch... CAS#:57728-59-3 |
| Literature: Journal of the American Chemical Society, , vol. 102, # 22 p. 6828 - 6837 |
|
~%
Glycine,N-(3-ch... CAS#:57728-59-3 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 122, p. 129 |
|
~%
Glycine,N-(3-ch... CAS#:57728-59-3 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 122, p. 129 |
|
~%
Glycine,N-(3-ch... CAS#:57728-59-3 |
| Literature: Journal of Biological Chemistry, , vol. 67, p. 557 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-chlorobenzoylglycine |
| 3-Chlor-hippursaeure |
| m-chlorohippurate |
| m-chlorohippuric acid |
| 3-Chlor-benzaminoessigsaeure |
| 3-Chlorohippuric acid |