1-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrrolidine structure
|
Common Name | 1-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 57440-57-0 | Molecular Weight | 209.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)pyrrolidine |
|---|
| Molecular Formula | C12H19NO2 |
|---|---|
| Molecular Weight | 209.28500 |
| Exact Mass | 209.14200 |
| PSA | 21.70000 |
| LogP | 1.83100 |
| InChIKey | RFIQCNQKQADCRU-UHFFFAOYSA-N |
| SMILES | C1=C(N2CCCC2)CCC2(C1)OCCO2 |
|
~80%
1-(1,4-dioxaspi... CAS#:57440-57-0 |
| Literature: Haga, Kazuo; Oohashi, Masayuki; Kaneko, Ryohei Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 6 p. 1586 - 1590 |
|
~%
1-(1,4-dioxaspi... CAS#:57440-57-0 |
| Literature: Haga, Kazuo; Oohashi, Masayuki; Kaneko, Ryohei Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 6 p. 1586 - 1590 |