Fexaramine structure
|
Common Name | Fexaramine | ||
|---|---|---|---|---|
| CAS Number | 574013-66-4 | Molecular Weight | 496.64000 | |
| Density | 1.158g/cm3 | Boiling Point | 677.7ºC at 760 mmHg | |
| Molecular Formula | C32H36N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 363.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of FexaramineFexaramine is a small molecule farnesoid X receptor (FXR) agonist with 100-fold increased affinity relative to natural compounds. IC50 value:Target:in vitro: In vitro treatment of CDCA or fexaramine elevated the SHP transcript level and occupancy on secretin promoter [1]. Fexaramine significantly enhanced osteoblastic differentiation through the upregulation of Runx2 and enhanced extracellular signal-regulated kinase (ERK) and β-catenin signaling [2]. By mimicking this tissue-selective effect, the gut-restricted FXR agonist fexaramine (Fex) robustly induces enteric fibroblast growth factor 15 (FGF15), leading to alterations in BA composition, but does so without activating FXR target genes in the liver [3]. |
| Name | Fexaramine,3-[3-[(Cyclohexylcarbonyl)-[[4'-(dimethylamino)-[1,1'-biphenyl]-4-yl]methyl]amino]phenyl]-2-propenoicacidmethylester |
|---|---|
| Synonym | More Synonyms |
| Description | Fexaramine is a small molecule farnesoid X receptor (FXR) agonist with 100-fold increased affinity relative to natural compounds. IC50 value:Target:in vitro: In vitro treatment of CDCA or fexaramine elevated the SHP transcript level and occupancy on secretin promoter [1]. Fexaramine significantly enhanced osteoblastic differentiation through the upregulation of Runx2 and enhanced extracellular signal-regulated kinase (ERK) and β-catenin signaling [2]. By mimicking this tissue-selective effect, the gut-restricted FXR agonist fexaramine (Fex) robustly induces enteric fibroblast growth factor 15 (FGF15), leading to alterations in BA composition, but does so without activating FXR target genes in the liver [3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 677.7ºC at 760 mmHg |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.64000 |
| Flash Point | 363.7ºC |
| Exact Mass | 496.27300 |
| PSA | 49.85000 |
| LogP | 6.71930 |
| Appearance of Characters | yellow solid |
| Index of Refraction | 1.626 |
| InChIKey | VLQTUNDJHLEFEQ-KGENOOAVSA-N |
| SMILES | COC(=O)C=Cc1cccc(N(Cc2ccc(-c3ccc(N(C)C)cc3)cc2)C(=O)C2CCCCC2)c1 |
| Storage condition | -20℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H413 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |
| Fexaramine |