N-(carboxyheptyl)maleimide structure
|
Common Name | N-(carboxyheptyl)maleimide | ||
|---|---|---|---|---|
| CAS Number | 57079-00-2 | Molecular Weight | 239.26800 | |
| Density | 1.212g/cm3 | Boiling Point | 424.6ºC at 760mmHg | |
| Molecular Formula | C12H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | 8-(2,5-dioxopyrrol-1-yl)octanoic acid |
|---|
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 424.6ºC at 760mmHg |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.26800 |
| Flash Point | 210.6ºC |
| Exact Mass | 239.11600 |
| PSA | 74.68000 |
| LogP | 1.27450 |
| Index of Refraction | 1.526 |
| InChIKey | QQBCAPJSHSNYLE-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCN1C(=O)C=CC1=O |
|
~48%
N-(carboxyhepty... CAS#:57079-00-2 |
| Literature: Ambekar, Sarvottam Y.; Gowda, D. Channe Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1996 , vol. 35, # 3 p. 184 - 186 |
|
~%
N-(carboxyhepty... CAS#:57079-00-2 |
| Literature: Ambekar, Sarvottam Y.; Gowda, D. Channe Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1996 , vol. 35, # 3 p. 184 - 186 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |