4,4-difluoro-5-methyl-2-phenylpyrazol-3-one structure
|
Common Name | 4,4-difluoro-5-methyl-2-phenylpyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 56875-01-5 | Molecular Weight | 210.18000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8F2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4-difluoro-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8F2N2O |
|---|---|
| Molecular Weight | 210.18000 |
| Exact Mass | 210.06000 |
| PSA | 32.67000 |
| LogP | 1.54500 |
| InChIKey | DBPNTHKZUSEJDV-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1(F)F |
|
~37%
4,4-difluoro-5-... CAS#:56875-01-5 |
| Literature: Ying, Weiwen; Desmarteau, Darryl D.; Xu, Ze-Qi; Witz, Michael Journal of Fluorine Chemistry, 2000 , vol. 102, # 1-2 p. 135 - 139 |
|
~6%
4,4-difluoro-5-... CAS#:56875-01-5 |
| Literature: Ying, Weiwen; Desmarteau, Darryl D.; Xu, Ze-Qi; Witz, Michael Journal of Fluorine Chemistry, 2000 , vol. 102, # 1-2 p. 135 - 139 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,4-difluoro-5-methyl-2-phenyl-2,4-dihydro-pyrazol-3-one |
| 3H-Pyrazol-3-one,4,4-difluoro-2,4-dihydro-5-methyl-2-phenyl |
| 4,4-Difluoro-3-methyl-1-phenyl-2-pyrazolin-5-one |