(4E)-4-[(4-hydroxyanilino)methylidene]-5-methyl-2-phenylpyrazol-3-one
Modify Date: 2025-09-22 12:08:58
![(4E)-4-[(4-hydroxyanilino)methylidene]-5-methyl-2-phenylpyrazol-3-one Structure](https://image.chemsrc.com/caspic/278/23711-41-3.png)
(4E)-4-[(4-hydroxyanilino)methylidene]-5-methyl-2-phenylpyrazol-3-one structure
|
Common Name | (4E)-4-[(4-hydroxyanilino)methylidene]-5-methyl-2-phenylpyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 23711-41-3 | Molecular Weight | 293.32000 | |
| Density | 1.25g/cm3 | Boiling Point | 449.2ºC at 760mmHg | |
| Molecular Formula | C17H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.5ºC | |
| Name | (4E)-4-[(4-hydroxyanilino)methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 449.2ºC at 760mmHg |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.32000 |
| Flash Point | 225.5ºC |
| Exact Mass | 293.11600 |
| PSA | 64.93000 |
| LogP | 2.68430 |
| Vapour Pressure | 1.1E-08mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | GHPAAQCLWSDZOB-UHFFFAOYSA-N |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1C=Nc1ccc(O)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-hydroxy-anilinomethylene)-5-methyl-2-phenyl-2,4-dihydro-pyrazol-3-one |
| 2-Pyrazolin-5-one,4-((p-hydroxyanilino)methylene)-3-methyl-1-phenyl |
| 4-((p-Hydroxyanilino)methylene)-3-methyl-1-phenyl-2-pyrazolin-5-one |
| 2,4-dihydro-4-{[(4-hydroxyphenyl)amino]methylene}-5-methyl-2-phenyl-3H-pyrazol-3-one |
| 4-{[(4-hydroxyphenyl)amino]methylidene}-3-methyl-1-phenyl-4,5-dihydro-1H-pyrazol-5-one |