3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid structure
|
Common Name | 3,3,3-Trifluoro-2-(trifluoromethyl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 564-10-3 | Molecular Weight | 196.04800 | |
| Density | 1.602g/cm3 | Boiling Point | 125/750mm | |
| Molecular Formula | C4H2F6O2 | Melting Point | 50-53 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 22.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,3,3-trifluoro-2-(trifluoromethyl)propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.602g/cm3 |
|---|---|
| Boiling Point | 125/750mm |
| Melting Point | 50-53 °C(lit.) |
| Molecular Formula | C4H2F6O2 |
| Molecular Weight | 196.04800 |
| Flash Point | 22.5ºC |
| Exact Mass | 195.99600 |
| PSA | 37.30000 |
| LogP | 1.81180 |
| Index of Refraction | 1.301 |
| InChIKey | RAEAYTICAPHWJW-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C(F)(F)F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,C |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HS Code | 2915900090 |
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Novel way of separating polyfluorocarboxylic acids by ion-exclusion chromatography.
J. Chromatogr. A. 884(1-2) , 93-103, (2000) Ion-exclusion chromatography has been successfully applied to the separation of a number of polyfluorocarboxylic acids. The separation of various mono- and dibasic polyfluorocarboxylic acids having a ... |
| 3,3,3-trifluoro-2-(trifluoromethyl)propanoic acid |
| MFCD00464165 |