5-(2 4-DICHLOROPHENYL)FURFURAL structure
|
Common Name | 5-(2 4-DICHLOROPHENYL)FURFURAL | ||
|---|---|---|---|---|
| CAS Number | 56300-69-7 | Molecular Weight | 241.07000 | |
| Density | 1.392g/cm3 | Boiling Point | 359.7ºC at 760 mmHg | |
| Molecular Formula | C11H6Cl2O2 | Melting Point | 158-163ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 171.3ºC | |
| Name | 5-(2,4-Dichlorophenyl)-2-furaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760 mmHg |
| Melting Point | 158-163ºC(lit.) |
| Molecular Formula | C11H6Cl2O2 |
| Molecular Weight | 241.07000 |
| Flash Point | 171.3ºC |
| Exact Mass | 239.97400 |
| PSA | 30.21000 |
| LogP | 4.06590 |
| Index of Refraction | 1.605 |
| InChIKey | WTXWLFKNQYWFPK-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| Storage condition | 2-8°C |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD00141622 |
| 5-(2,4-dichlorophenyl)furan-2-carbaldehyde |