Methanone, bis (4-iodophenyl)- structure
|
Common Name | Methanone, bis (4-iodophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5630-56-8 | Molecular Weight | 434.01100 | |
| Density | 2.05g/cm3 | Boiling Point | 432.1ºC at 760 mmHg | |
| Molecular Formula | C13H8I2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | bis(4-iodophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 2.05g/cm3 |
|---|---|
| Boiling Point | 432.1ºC at 760 mmHg |
| Molecular Formula | C13H8I2O |
| Molecular Weight | 434.01100 |
| Flash Point | 215.2ºC |
| Exact Mass | 433.86600 |
| PSA | 17.07000 |
| LogP | 4.12680 |
| Index of Refraction | 1.7 |
| InChIKey | HFRHPJJBHNBGBD-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(I)cc1)c1ccc(I)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Bis(4-iodphenyl)methanon |
| 4,4'-Dijod-benzophenon |
| 4,4'-iodobenzophenone |
| Methanone,bis(4-iodophenyl) |
| 4,4'-Diiodobenzophenone |
| Benzophenone,4'-diiodo |
| di4-iodophenyl ketone |