Methanone,bis(4-nitrophenyl)- structure
|
Common Name | Methanone,bis(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1033-26-7 | Molecular Weight | 272.21300 | |
| Density | 1.423g/cm3 | Boiling Point | 484.7ºC at 760mmHg | |
| Molecular Formula | C13H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.3ºC | |
| Name | Bis(4-Nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423g/cm3 |
|---|---|
| Boiling Point | 484.7ºC at 760mmHg |
| Molecular Formula | C13H8N2O5 |
| Molecular Weight | 272.21300 |
| Flash Point | 246.3ºC |
| Exact Mass | 272.04300 |
| PSA | 108.71000 |
| LogP | 3.78040 |
| Vapour Pressure | 1.5E-09mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | IRFCWUHTGYXRNR-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| p,p'-dinitrobenzophenone |
| Methanone,bis(4-nitrophenyl) |
| 4,4'-Dinitro-benzophenon |
| 4,4'-dinitro-benzophenone |
| 3,3'-dinitrobenzophenone |
| Bis-(4-nitro-phenyl)-keton |