Methanone,bis(4-amino-2-ethoxy-5-thiazolyl)- structure
|
Common Name | Methanone,bis(4-amino-2-ethoxy-5-thiazolyl)- | ||
|---|---|---|---|---|
| CAS Number | 86695-78-5 | Molecular Weight | 314.38400 | |
| Density | 1.438g/cm3 | Boiling Point | 572.2ºC at 760mmHg | |
| Molecular Formula | C11H14N4O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.9ºC | |
| Name | bis(4-amino-2-ethoxy-1,3-thiazol-5-yl)methanone |
|---|
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 572.2ºC at 760mmHg |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.38400 |
| Flash Point | 299.9ºC |
| Exact Mass | 314.05100 |
| PSA | 169.83000 |
| LogP | 2.95480 |
| Index of Refraction | 1.653 |
| InChIKey | WLASZMFAJQFYEX-UHFFFAOYSA-N |
| SMILES | CCOc1nc(N)c(C(=O)c2sc(OCC)nc2N)s1 |
|
~54%
Methanone,bis(4... CAS#:86695-78-5 |
| Literature: Fuchigami, Toshio; Nonaka, Tsutomu Journal of Organic Chemistry, 1983 , vol. 48, # 19 p. 3340 - 3341 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |