2,3,5,6-Tetramethoxyaporphine structure
|
Common Name | 2,3,5,6-Tetramethoxyaporphine | ||
|---|---|---|---|---|
| CAS Number | 5630-11-5 | Molecular Weight | 355.42800 | |
| Density | 1.166g/cm3 | Boiling Point | 487ºC at 760 mmHg | |
| Molecular Formula | C21H25NO4 | Melting Point | 119ºC | |
| MSDS | N/A | Flash Point | 140.2ºC | |
Use of 2,3,5,6-Tetramethoxyaporphine2,3,5,6-Tetramethoxyaporphine is an antitussive agent, a medicinally valuable benzyl isoquinoline alkaloid. 2,3,5,6-Tetramethoxyaporphine can be isolated from the yellow hornpoppy, Glaucium flavum Cr. (Fam. Papaveraceae)[1][2]. |
| Name | 1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline |
|---|---|
| Synonym | More Synonyms |
| Description | 2,3,5,6-Tetramethoxyaporphine is an antitussive agent, a medicinally valuable benzyl isoquinoline alkaloid. 2,3,5,6-Tetramethoxyaporphine can be isolated from the yellow hornpoppy, Glaucium flavum Cr. (Fam. Papaveraceae)[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 487ºC at 760 mmHg |
| Melting Point | 119ºC |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.42800 |
| Flash Point | 140.2ºC |
| Exact Mass | 355.17800 |
| PSA | 40.16000 |
| LogP | 3.41100 |
| Index of Refraction | 1.575 |
| InChIKey | RUZIUYOSRDWYQF-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)-c1c(OC)c(OC)cc3c1C(C2)N(C)CC3 |
| (1)-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo(de,g)quinoline |
| (+/-)-glaucine |
| lauroscholtzine |
| 1,2,9,10-tetramethoxyaporphine |
| rac-1,2,9,10-tetramethoxy-6-methyl-aporphane |
| glaucine phosphate |
| tussiglaucin |
| (+/-)-5,6,6a,7-tetrahydro-1,2,9,10-tetramethoxy-6-methyl-4H-dibenzo[de,g]quinoline |