CGP 13501 structure
|
Common Name | CGP 13501 | ||
|---|---|---|---|---|
| CAS Number | 56189-68-5 | Molecular Weight | 290.44 | |
| Density | 0.965g/cm3 | Boiling Point | 344.8ºC at 760 mmHg | |
| Molecular Formula | C19H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.8ºC | |
Use of CGP 13501CGP13501 is a positive allosteric modulator of GABAB receptor. CGP13501 is a structural analogue of propofol[1]. |
| Name | 3-(3,5-di-tert-butyl-4-hydroxyphenyl)-2,2-dimethyl-propionaldehyde |
|---|
| Description | CGP13501 is a positive allosteric modulator of GABAB receptor. CGP13501 is a structural analogue of propofol[1]. |
|---|---|
| Related Catalog | |
| Target |
GABAB receptor[1] |
| References |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 344.8ºC at 760 mmHg |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.44 |
| Flash Point | 146.8ºC |
| Exact Mass | 290.22500 |
| PSA | 37.30000 |
| LogP | 4.75480 |
| Index of Refraction | 1.499 |
| InChIKey | XGWATTXMMMANFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C=O)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| WGK Germany | 3 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 1 | |