N-[4-(3 3 4 4 5 5 6 6 7 7 8 8 9 9 10 10 structure
|
Common Name | N-[4-(3 3 4 4 5 5 6 6 7 7 8 8 9 9 10 10 | ||
|---|---|---|---|---|
| CAS Number | 556050-49-8 | Molecular Weight | 695.32300 | |
| Density | 1.59g/cm3 | Boiling Point | 466.5ºC at 760 mmHg | |
| Molecular Formula | C22H14F17NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 235.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2,5-dioxopyrrolidin-1-yl) [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 466.5ºC at 760 mmHg |
| Molecular Formula | C22H14F17NO5 |
| Molecular Weight | 695.32300 |
| Flash Point | 235.9ºC |
| Exact Mass | 695.06000 |
| PSA | 72.91000 |
| LogP | 7.28370 |
| Index of Refraction | 1.423 |
| InChIKey | DLEHONFUGNNFOG-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)ON1C(=O)CCC1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
|
~81%
N-[4-(3 3 4 4 5... CAS#:556050-49-8 |
| Literature: FLUOROUS TECHNOLOGIES INCORPORATED Patent: WO2004/7407 A2, 2004 ; Location in patent: Page 49, 50 ; |
|
~80%
N-[4-(3 3 4 4 5... CAS#:556050-49-8 |
| Literature: Curran, Dennis P.; Amatore, Muriel; Guthrie, David; Campbell, Matthew; Go, Eisan; Luo, Zhiyong Journal of Organic Chemistry, 2003 , vol. 68, # 12 p. 4643 - 4647 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| MFCD04973831 |