[4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methanol structure
|
Common Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 356055-77-1 | Molecular Weight | 554.24100 | |
| Density | 1.535g/cm3 | Boiling Point | 323.564ºC at 760 mmHg | |
| Molecular Formula | C17H11F17O | Melting Point | 81-85ºC | |
| MSDS | Chinese USA | Flash Point | 149.486ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.535g/cm3 |
|---|---|
| Boiling Point | 323.564ºC at 760 mmHg |
| Melting Point | 81-85ºC |
| Molecular Formula | C17H11F17O |
| Molecular Weight | 554.24100 |
| Flash Point | 149.486ºC |
| Exact Mass | 554.05400 |
| PSA | 20.23000 |
| LogP | 7.12090 |
| Index of Refraction | 1.371 |
| InChIKey | CQOQAOKSHAECHG-UHFFFAOYSA-N |
| SMILES | OCc1ccc(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2906299090 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)phenyl)methanol |
| 4-(1H,1H,2H,2H-Perfluorodecyl)benzyl alcohol |
| MFCD03788346 |
| 4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecyl)benzyl alcohol |
| 4-(2-perfluorooctyl)ethylbenzylalcohol |