1-[3-(Trifluoromethyl)benzyl]piperazine
Modify Date: 2025-08-25 21:49:40
![1-[3-(Trifluoromethyl)benzyl]piperazine Structure](https://image.chemsrc.com/caspic/491/55513-16-1.png)
1-[3-(Trifluoromethyl)benzyl]piperazine structure
|
Common Name | 1-[3-(Trifluoromethyl)benzyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 55513-16-1 | Molecular Weight | 244.256 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 275.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H15F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5±25.9 °C | |
| Name | 1-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 275.6±35.0 °C at 760 mmHg |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.256 |
| Flash Point | 120.5±25.9 °C |
| Exact Mass | 244.118729 |
| PSA | 15.27000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | IUMQPHHEFKTLOZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(CN2CCNCC2)c1 |
| Hazard Codes | Xn,Xi |
|---|---|
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2810 6.1/PG 3 |
| HS Code | 2933599090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:110-85-0
CAS#:705-29-3| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[3-(Trifluoromethyl)benzyl]piperazine |
| N-[3-(trifluoromethyl)benzyl]piperazine |
| 1-(3-trifluoromethylbenzyl)piperazine |
| 1-(3-Trifluoromethylbenzyl)piperazine 2HCl |
| 1-{[3-(trifluoromethyl)phenyl]methyl}piperazine |
| Piperazine, 1-[[3-(trifluoromethyl)phenyl]methyl]- |