4-(tert-Butyl-dimethyl-silanyloxy)-cyclohexanone structure
|
Common Name | 4-(tert-Butyl-dimethyl-silanyloxy)-cyclohexanone | ||
|---|---|---|---|---|
| CAS Number | 55145-45-4 | Molecular Weight | 228.40300 | |
| Density | 0.909 g/mL at 25ºC(lit.) | Boiling Point | 85ºC1 mm Hg(lit.) | |
| Molecular Formula | C12H24O2Si | Melting Point | N/A | |
| MSDS | USA | Flash Point | >230 °F | |
| Name | 4-(tert-Butyldimethylsilyloxy)cyclohexanone |
|---|---|
| Synonym | More Synonyms |
| Density | 0.909 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 85ºC1 mm Hg(lit.) |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.40300 |
| Flash Point | >230 °F |
| Exact Mass | 228.15500 |
| PSA | 26.30000 |
| LogP | 3.51990 |
| Index of Refraction | n20/D 1.4530(lit.) |
| InChIKey | HXKBGMNGSYGPRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(=O)CC1 |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
| HS Code | 2931900090 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-one |
| MFCD06411307 |