11-hydroxy-5,8,12,14-eicosatetraenoic acid
Modify Date: 2025-09-18 16:53:46
11-hydroxy-5,8,12,14-eicosatetraenoic acid structure
|
Common Name | 11-hydroxy-5,8,12,14-eicosatetraenoic acid | ||
|---|---|---|---|---|
| CAS Number | 54886-50-9 | Molecular Weight | 320.466 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 487.7±33.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.8±21.9 °C | |
Use of 11-hydroxy-5,8,12,14-eicosatetraenoic acidThe synthesis of 11-HETE by rat PMNL has been reported, but the stereochemistry of the 11-HETE produced is not defined. |
| Name | (11S)-11-hydroxyicosa-5,8,12,14-tetraenoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.7±33.0 °C at 760 mmHg |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.466 |
| Flash Point | 262.8±21.9 °C |
| Exact Mass | 320.235138 |
| PSA | 57.53000 |
| LogP | 5.45 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | GCZRCCHPLVMMJE-JQBFKNNWSA-N |
| SMILES | CCCCCC=CC=CC(O)CC=CCC=CCCCC(=O)O |
| Hazard Codes | F,Xi |
|---|---|
| Risk Phrases | 11-36/37/38 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 1170 3/PG 2 |
| HS Code | 2918199090 |
|
~%
11-hydroxy-5,8,... CAS#:54886-50-9 |
| Literature: Kato, Tadahiro; Watanabe, Tsutomu; Hirukawa, Toshifumi; Tomita, Norihiro; Namai, Tsuneo Bulletin of the Chemical Society of Japan, 1996 , vol. 69, # 6 p. 1663 - 1666 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (5E,8E,12E,14E)-11-Hydroxy-5,8,12,14-icosatetraenoic acid |
| 11-HETE |
| 5,8,12,14-Eicosatetraenoic acid, 11-hydroxy-, (5Z,8Z,11S,12E,14Z)- |
| 5,8,12,14-Eicosatetraenoic acid, 11-hydroxy-, (5E,8E,12E,14E)- |
| 11-S-Hydroxyeicosatetraenoic acid |
| 5,8,12,14-Eicosatetraenoic acid, 11-hydroxy-, (E,Z,Z,Z)- |
| (5Z,8Z,11S,12E,14Z)-11-Hydroxy-5,8,12,14-icosatetraenoic acid |
| 11-hydroxy-5,8,12,14-eicosatetraenoic acid |