11-HEPE structure
|
Common Name | 11-HEPE | ||
|---|---|---|---|---|
| CAS Number | 99217-78-4 | Molecular Weight | 318.450 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 488.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1±25.2 °C | |
Use of 11-HEPE(±)11-HEPE is produced by non-enzymatic oxidation of eicosapentaenoic acid. |
| Name | (±)11-hepe |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.0±45.0 °C at 760 mmHg |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.450 |
| Flash Point | 263.1±25.2 °C |
| Exact Mass | 318.219482 |
| PSA | 57.53000 |
| LogP | 4.93 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | IDEHSDHMEMMYIR-DPIPZTQVSA-N |
| SMILES | CCC=CCC=CC=CC(O)CC=CCC=CCCCC(=O)O |
| (5Z,8Z,12E,14Z,17Z)-11-Hydroxy-5,8,12,14,17-icosapentaenoic acid |
| 5,8,12,14,17-Eicosapentaenoic acid, 11-hydroxy-, (5Z,8Z,12E,14Z,17Z)- |
| 11-HEPE |