tert-Butyl (4-hydroxyphenyl)carbamate structure
|
Common Name | tert-Butyl (4-hydroxyphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 54840-15-2 | Molecular Weight | 209.242 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 288.7±23.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO3 | Melting Point | 143-147 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 128.4±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-Butyl 4-hydroxyphenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.7±23.0 °C at 760 mmHg |
| Melting Point | 143-147 °C(lit.) |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.242 |
| Flash Point | 128.4±22.6 °C |
| Exact Mass | 209.105194 |
| PSA | 58.56000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | YRQMBQUMJFVZLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(O)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Synthesis of Bifunctional Azobenzene Glycoconjugates for Cysteine-Based Photosensitive Cross-Linking with Bioactive Peptides.
Chemistry 21 , 13723-31, (2015) Azobenzene linker molecules can be utilized to control peptide/protein function when they are ligated to appropriately spaced amino acid side chains of the peptide. This is because the photochemical E... |
|
|
Discovery of novel SERCA inhibitors by virtual screening of a large compound library.
Eur. J. Med. Chem. 46 , 1512-23, (2011) Two screening protocols based on recursive partitioning and computational ligand docking methodologies, respectively, were employed for virtual screens of a compound library with 345,000 entries for n... |
| 2-Methyl-2-propanyl (4-hydroxyphenyl)carbamate |
| tert-butyl N-(4-hydroxyphenyl)carbamate |
| MFCD00226573 |
| tert-butyl (4-hydroxyphenyl)carbamate |
| Carbamic acid, N-(4-hydroxyphenyl)-, 1,1-dimethylethyl ester |