Siastatin B microbial
Siastatin B microbial structure
|
Common Name | Siastatin B microbial | ||
|---|---|---|---|---|
| CAS Number | 54795-58-3 | Molecular Weight | 218.20700 | |
| Density | 1.48g/cm3 | Boiling Point | 579.2ºC at 760 mmHg | |
| Molecular Formula | C8H14N2O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 304.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Siastatin B |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 579.2ºC at 760 mmHg |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.20700 |
| Flash Point | 304.1ºC |
| Exact Mass | 218.09000 |
| PSA | 118.89000 |
| Index of Refraction | 1.581 |
| InChIKey | DQTKLICLJUKNCG-ZTYPAOSTSA-N |
| SMILES | CC(=O)NC1NCC(C(=O)O)C(O)C1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| RTECS | TM6125400 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Contributions of NanI sialidase to Caco-2 cell adherence by Clostridium perfringens type A and C strains causing human intestinal disease.
Infect. Immun. 82(11) , 4620-30, (2014) Previous studies showed that Clostridium perfringens type D animal disease strain CN3718 uses NanI sialidase for adhering to enterocyte-like Caco-2 cells. The current study analyzed whether NanI is si... |
|
|
Syntheses and activities of N-substituted derivatives of siastatin B.
J. Antibiot. 45(10) , 1662-8, (1992) N-Substituted derivatives of siastatin B have been obtained by a chemical modification. Some derivatives showed potent inhibitory activities against Streptococcus sp. and Clostridium perfringens neura... |
|
|
Synthesis of 3-episiastatin B analogues having anti-influenza virus activity.
J. Antibiot. 46(12) , 1883-9, (1993) Two epimers of siastatin B, 3-episiastatin B (3) and 3,4-diepisiastatin B (4), were obtained by the chemical modification of siastatin B. Compound 3 showed marked inhibitory activity against influenza... |
| (3S,4S,5R,6R)-6-acetamido-4,5-dihydroxypiperidine-3-carboxylic acid |