2,5-Cyclohexadien-1-one,4-chloro-2,4,6-tris(1,1-dimethylethyl)- structure
|
Common Name | 2,5-Cyclohexadien-1-one,4-chloro-2,4,6-tris(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5457-60-3 | Molecular Weight | 296.87500 | |
| Density | 0.98g/cm3 | Boiling Point | 364.6ºC at 760mmHg | |
| Molecular Formula | C18H29ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.3ºC | |
| Name | 2,4,6-tritert-butyl-4-chlorocyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.98g/cm3 |
|---|---|
| Boiling Point | 364.6ºC at 760mmHg |
| Molecular Formula | C18H29ClO |
| Molecular Weight | 296.87500 |
| Flash Point | 255.3ºC |
| Exact Mass | 296.19100 |
| PSA | 17.07000 |
| LogP | 5.53780 |
| Index of Refraction | 1.491 |
| InChIKey | NEQLTAGYGHWRSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(Cl)(C(C)(C)C)C=C(C(C)(C)C)C1=O |
| HS Code | 2914700090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-chloro-2,4,6-tritertbutylcyclohexadienone |
| 2,2,4,6-tri-tert-butyl-4-chloro |
| 4-Chloro-2,4,6-tri-tert-butyl-2,5-cyclohexadien-1-one |
| 4-chloro-2,4,6-tri-t-butyl-2,5-cyclohexadien-1-one |
| 2,4,6-tri-tert-butyl-4-chloro-cyclohexa-2,5-dienone |
| 2,5-Cyclohexadien-1-one,2,4,6-tri-tert-butyl-4-chloro |
| 2,4,6-Tri-tert-butyl-4-chlor-cyclohexa-2,5-dienon |