2,4'-Dimethoxybenzophenone structure
|
Common Name | 2,4'-Dimethoxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 5449-69-4 | Molecular Weight | 242.27000 | |
| Density | 1.123 g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | (2-methoxyphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123 g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 193.4ºC |
| Exact Mass | 242.09400 |
| PSA | 35.53000 |
| LogP | 2.93480 |
| Index of Refraction | 1.557 |
| InChIKey | QWWJLMQOKZOTNX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2OC)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4'-Dimethoxybenzophenone |
| 2,4'-Dimethoxy-benzophenon |
| (2-methoxyphenyl)(4-methoxyphenyl)methanone |
| (4-methoxyphenyl)-(2-methoxyphenyl)-methanone |
| 2,3-DIFLUOROMANDELIC ACID |
| 4,2'-DIMETHOXYBENZOPHENONE |
| 2-methoxyphenyl 4-methoxyphenyl ketone |