Benzenemethanol,2-(ethoxymethyl)-a-(2-methoxyphenyl)-a-(4-methoxyphenyl)-
Modify Date: 2025-09-25 19:12:10
Benzenemethanol,2-(ethoxymethyl)-a-(2-methoxyphenyl)-a-(4-methoxyphenyl)- structure
|
Common Name | Benzenemethanol,2-(ethoxymethyl)-a-(2-methoxyphenyl)-a-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6636-18-6 | Molecular Weight | 378.46100 | |
| Density | 1.133g/cm3 | Boiling Point | 522.9ºC at 760 mmHg | |
| Molecular Formula | C24H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.1ºC | |
| Name | [2-(ethoxymethyl)phenyl]-(2-methoxyphenyl)-(4-methoxyphenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 522.9ºC at 760 mmHg |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.46100 |
| Flash Point | 270.1ºC |
| Exact Mass | 378.18300 |
| PSA | 47.92000 |
| LogP | 4.52450 |
| Index of Refraction | 1.574 |
| InChIKey | HDOHJPQPDPDOKI-UHFFFAOYSA-N |
| SMILES | CCOCc1ccccc1C(O)(c1ccc(OC)cc1)c1ccccc1OC |
|
~%
Benzenemethanol... CAS#:6636-18-6 |
| Literature: Blicke; Weinkauff Journal of the American Chemical Society, 1932 , vol. 54, p. 1446,1451 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-Dimethyl-mandelsaeure |
| 2,5-dimethyl-mandelic acid |
| 2.5-Dimethyl-phenylglykolsaeure |