R-Tetrahydropapaverine
Modify Date: 2025-08-26 22:16:54
R-Tetrahydropapaverine structure
|
Common Name | R-Tetrahydropapaverine | ||
|---|---|---|---|---|
| CAS Number | 54417-53-7 | Molecular Weight | 379.88 | |
| Density | 1.12 g/cm3 | Boiling Point | 475.8ºC at 760 mmHg | |
| Molecular Formula | C20H26ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.7ºC | |
Use of R-Tetrahydropapaverine(R)-Tetrahydropapaverine hydrochloride is the inactive isomer of Tetrahydropapaverine hydrochloride (HY-N0137), and can be used as an experimental control. Tetrahydropapaverine hydrochloride is one of the Tetrahydroisoquinolines. Tetrahydropapaverine hydrochloride has neurotoxic effects on dopamine neurons[1][2]. |
| Name | R-Tetrahydropapaverine |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-Tetrahydropapaverine hydrochloride is the inactive isomer of Tetrahydropapaverine hydrochloride (HY-N0137), and can be used as an experimental control. Tetrahydropapaverine hydrochloride is one of the Tetrahydroisoquinolines. Tetrahydropapaverine hydrochloride has neurotoxic effects on dopamine neurons[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.12 g/cm3 |
|---|---|
| Boiling Point | 475.8ºC at 760 mmHg |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 |
| Flash Point | 202.7ºC |
| Exact Mass | 379.155029 |
| PSA | 48.95000 |
| LogP | 4.28130 |
| Index of Refraction | 1.549 |
| InChIKey | VMPLLPIDRGXFTQ-PKLMIRHRSA-N |
| SMILES | COc1ccc(CC2NCCc3cc(OC)c(OC)cc32)cc1OC.Cl |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R52/53 |
| Safety Phrases | S22-S61 |
| HS Code | 2933499090 |
|
~%
R-Tetrahydropap... CAS#:54417-53-7 |
| Literature: WO2009/106547 A1, ; Page/Page column 9-10 ; |
|
~%
R-Tetrahydropap... CAS#:54417-53-7 |
| Literature: Tetrahedron Letters, , vol. 22, # 39 p. 3869 - 3872 |
![1-[(3,4-Dimethoxyphenyl)methyl]-3,4-dihydro-6,7-dimethoxyisoquinoline structure](https://image.chemsrc.com/caspic/235/6957-27-3.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (R)-(-)-Norlaudanosine Hydrochloride |
| (R)-1-((3,4-dimethoxyphenyyl)methyl)-1,2,3,4-tetrahydro-6,7-dimethoxyisoquinoline hydrochloride |
| MFCD03788189 |
| (R)-Tetrahydropapaverinehydrochloride |
| EINECS 415-110-8 |
| R-(+)-TETRAHYDROPAPAVERIN HYDROCHLORIDE |
| http://www.gabrielpharm.com/hy/detailpro.phpid=39 |
| (R)-1,2,3,4-tetrahydropapaverine hydrochloride |
| (R)-tetrahydropaverine hydrochloride |
| Isoquinoline, 1-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydro-6,7-dimethoxy-, hydrochloride (1:1) |
| (R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride |
| D-(-)-Norlaudanosine hydrochloride |
| (R)-1-(3,4-DIMETHOXY-BENZYL)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDRO-ISOQUINOLINE HCL |
| R-BINAP |
| 1-(3,4-Dimethoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride (1:1) |
| R-(+)-Tetrahydropapaverin |
| (r)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline |
| R-(-)-norlaudanosine*HCl |
| R-tetrahydropapaverine HCl |