Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate structure
|
Common Name | Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate | ||
|---|---|---|---|---|
| CAS Number | 54278-10-3 | Molecular Weight | 267.32100 | |
| Density | 1.111 g/cm3 | Boiling Point | 389.8ºC at 760 mmHg | |
| Molecular Formula | C14H21NO4 | Melting Point | 75-77 °C(lit.) | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Name | Ethyl 4-(3-ethoxy-3-oxopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111 g/cm3 |
|---|---|
| Boiling Point | 389.8ºC at 760 mmHg |
| Melting Point | 75-77 °C(lit.) |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32100 |
| Flash Point | 189.5ºC |
| Exact Mass | 267.14700 |
| PSA | 68.39000 |
| LogP | 2.30390 |
| Index of Refraction | 1.51 |
| InChIKey | ZYNJVGCLOFPWFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1c(C)[nH]c(C(=O)OCC)c1C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00010644 |
| ethyl 4-(3-ethoxy-3-oxopropyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |