PPAR agonist 1
Modify Date: 2025-08-22 02:39:26
PPAR agonist 1 structure
|
Common Name | PPAR agonist 1 | ||
|---|---|---|---|---|
| CAS Number | 539813-69-9 | Molecular Weight | 407.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PPAR agonist 1PPAR agonist 1 is an agonist of PPAR α and PPAR γ, used for reducing blood glucose, lipid levels, lowering cholesterol and reducing body weight. |
| Name | PPAR agonist 1 |
|---|
| Description | PPAR agonist 1 is an agonist of PPAR α and PPAR γ, used for reducing blood glucose, lipid levels, lowering cholesterol and reducing body weight. |
|---|---|
| Related Catalog | |
| Target |
PPARα PPARγ |
| References |
| Molecular Weight | 407.48 |
|---|---|
| InChIKey | HFRCAKXUSHNVLY-IBGZPJMESA-N |
| SMILES | COC(Cc1ccc(NCCCc2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)O |