ethyl 2-chloro-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate structure
|
Common Name | ethyl 2-chloro-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate | ||
|---|---|---|---|---|
| CAS Number | 53729-07-0 | Molecular Weight | 329.99500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-chloro-2-[(2,4,6-trichlorophenyl)hydrazinylidene]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8Cl4N2O2 |
|---|---|
| Molecular Weight | 329.99500 |
| Exact Mass | 327.93400 |
| PSA | 50.69000 |
| LogP | 4.24710 |
| InChIKey | NDKJJMNJPYSZDC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)=NNc1c(Cl)cc(Cl)cc1Cl |
|
~%
ethyl 2-chloro-... CAS#:53729-07-0 |
| Literature: Chattaway; Daldy Journal of the Chemical Society, 1928 , p. 2761,2762 |
|
~%
ethyl 2-chloro-... CAS#:53729-07-0 |
| Literature: Chattaway; Daldy Journal of the Chemical Society, 1928 , p. 2761,2762 |
| Acetic acid,chloro[(2,4,6-trichlorophenyl)hydrazono]-,ethyl ester |
| Chlor-(2,4,6-trichlor-phenylhydrazono)-essigsaeure-aethylester |
| ethyl chloroglyoxylate 2-(2,4,6-trichlorophenyl)-hydrazone |
| chloro-(2,4,6-trichloro-phenylhydrazono)-acetic acid ethyl ester |