N-[4-[(E)-3-(4-dimethylaminophenyl)prop-2-enoyl]phenyl]acetamide structure
|
Common Name | N-[4-[(E)-3-(4-dimethylaminophenyl)prop-2-enoyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5336-80-1 | Molecular Weight | 308.37400 | |
| Density | 1.181g/cm3 | Boiling Point | 559.9ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.4ºC | |
| Name | n-[4-[3-[4-(dimethylamino)phenyl]-2-propenoyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 559.9ºC at 760 mmHg |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.37400 |
| Flash Point | 292.4ºC |
| Exact Mass | 308.15200 |
| PSA | 49.41000 |
| LogP | 3.68010 |
| Index of Refraction | 1.654 |
| InChIKey | PNSVICPSMTUZNX-AWNIVKPZSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)C=Cc2ccc(N(C)C)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~73%
N-[4-[(E)-3-(4-... CAS#:5336-80-1 |
| Literature: Tristao; Campos-Buzzi; Correa; Cruz; Cechinel Filho; Bella Cruz Arzneimittel-Forschung/Drug Research, 2012 , vol. 62, # 12 p. 590 - 594 |
|
~%
N-[4-[(E)-3-(4-... CAS#:5336-80-1 |
| Literature: De Campos-Buzzi, Fatima; Padaratz, Pamela; Meira, Aleandra Vergilina; Correa, Rogerio; Nunes, Ricardo Jose; Cechinel-Filho, Valdir Molecules, 2007 , vol. 12, # 4 p. 896 - 906 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Hydroxy-4-dimethylamino-tetrahydrofuran |
| 4-Dimethylamino-3-trifluormethylanilin |
| 4-Dimethylamino-3-tetrahydrofuranol |
| 4-dimethylamino-4'-acetylamino-trans-chalcone |
| 4-Dimethylamino-4'-acetamino-trans-chalkon |