2-(4-CHLOROANILINO)-1-PHENYL-1-ETHANONE structure
|
Common Name | 2-(4-CHLOROANILINO)-1-PHENYL-1-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 53181-22-9 | Molecular Weight | 245.70400 | |
| Density | 1.248g/cm3 | Boiling Point | 429.3ºC at 760mmHg | |
| Molecular Formula | C14H12ClNO | Melting Point | 164-166ºC | |
| MSDS | N/A | Flash Point | 213.4ºC | |
| Name | 2-(4-chloroanilino)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 429.3ºC at 760mmHg |
| Melting Point | 164-166ºC |
| Molecular Formula | C14H12ClNO |
| Molecular Weight | 245.70400 |
| Flash Point | 213.4ºC |
| Exact Mass | 245.06100 |
| PSA | 29.10000 |
| LogP | 3.70780 |
| Index of Refraction | 1.634 |
| InChIKey | SJWIVINUBMHTIV-UHFFFAOYSA-N |
| SMILES | O=C(CNc1ccc(Cl)cc1)c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MA-0715 |
| 1-phenyl-2-((4-chlorophenyl)amino)ethanone |
| 2-(4-chloro-anilino)-1-phenyl-ethanone |
| 2-(4-Chlor-anilino)-1-phenyl-aethanon |
| p-Chlorophenacylaniline |
| 2-(4-chlorophenylamino)-1-phenylethanone |
| chloroanilinophenylethanone |
| 2-(2-FLUORO-PHENYL)-2-MORPHOLIN-4-YL-ETHYLAMINE |