phenacyl 3-nitrobenzenesulfonate structure
|
Common Name | phenacyl 3-nitrobenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 112537-84-5 | Molecular Weight | 321.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenacyl 3-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11NO6S |
|---|---|
| Molecular Weight | 321.30500 |
| Exact Mass | 321.03100 |
| PSA | 114.64000 |
| LogP | 3.78700 |
| InChIKey | WMQFMCGUNNEBEC-UHFFFAOYSA-N |
| SMILES | O=C(COS(=O)(=O)c1cccc([N+](=O)[O-])c1)c1ccccc1 |
|
~39%
phenacyl 3-nitr... CAS#:112537-84-5 |
| Literature: Lee, Ikchoon; Shim, Chang Sub; Chung, Soo Young; Lee, Hai Whang Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1988 , p. 975 - 982 |
| Benzenesulfonic acid,3-nitro-,2-oxo-2-phenylethyl ester |
| phenacyl m-nitrobenzenesulphonate |